C29H42O2 — CID 23338789
2-[(1E,3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]-6-ethoxy-3-methyl-3,6-dihydro-2H-pyran (PubChem CID 23338789) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]-6-ethoxy-3-methyl-3,6-dihydro-2H-pyran.
| Compound Name | 2-[(1E,3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]-6-ethoxy-3-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 23338789 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 2-[(1E,3E,5E,7E,9E)-4,8-dimethyl-10-(2,6,6-trimethylcyclohexen-1-yl)deca-1,3,5,7,9-pentaenyl]-6-ethoxy-3-methyl-3,6-dihydro-2H-pyran |
| SMILES | CCOC1C=CC(C)C(/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)O1 |
| InChI | InChI=1S/C29H42O2/c1-8-30-28-20-18-25(5)27(31-28)16-10-14-22(2)12-9-13-23(3)17-19-26-24(4)15-11-21-29(26,6)7/h9-10,12-14,16-20,25,27-28H,8,11,15,21H2,1-7H3/b12-9+,16-10+,19-17+,22-14+,23-13+ |
| InChIKey | JSIRHOZPJCIVRH-QLDKFUCNSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|