C19H32O3 — CID 23338790
(2E,6E)-5,9-diethoxy-3,7,11-trimethyldodeca-2,6,10-trienal (PubChem CID 23338790) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (2E,6E)-5,9-diethoxy-3,7,11-trimethyldodeca-2,6,10-trienal.
| Compound Name | (2E,6E)-5,9-diethoxy-3,7,11-trimethyldodeca-2,6,10-trienal |
|---|---|
| PubChem CID | 23338790 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (2E,6E)-5,9-diethoxy-3,7,11-trimethyldodeca-2,6,10-trienal |
| SMILES | CCOC(C=C(C)C)C/C(C)=C/C(C/C(C)=C/C=O)OCC |
| InChI | InChI=1S/C19H32O3/c1-7-21-18(11-15(3)4)13-17(6)14-19(22-8-2)12-16(5)9-10-20/h9-11,14,18-19H,7-8,12-13H2,1-6H3/b16-9+,17-14+ |
| InChIKey | KLLQAVLVYREINF-LLYMPXGKSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|