C21H32O2 — CID 23338791
6-methoxy-4-methyl-2-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-3,6-dihydro-2H-pyran (PubChem CID 23338791) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 6-methoxy-4-methyl-2-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-3,6-dihydro-2H-pyran.
| Compound Name | 6-methoxy-4-methyl-2-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 23338791 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 6-methoxy-4-methyl-2-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-3,6-dihydro-2H-pyran |
| SMILES | COC1C=C(C)CC(/C=C(C)/C=C/C2=C(C)CCCC2(C)C)O1 |
| InChI | InChI=1S/C21H32O2/c1-15(12-18-13-16(2)14-20(22-6)23-18)9-10-19-17(3)8-7-11-21(19,4)5/h9-10,12,14,18,20H,7-8,11,13H2,1-6H3/b10-9+,15-12+ |
| InChIKey | CFDPPVASFYXFJK-MKQCFFQWSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|