About butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate
butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 23338792) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate.
Molecular Properties
| Compound Name | butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate |
| PubChem CID | 23338792 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | CCCCOC(=O)C1CC(C)=CC(OC)O1 |
| InChI | InChI=1S/C12H20O4/c1-4-5-6-15-12(13)10-7-9(2)8-11(14-3)16-10/h8,10-11H,4-7H2,1-3H3 |
| InChIKey | QCACWWQDZOWTII-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate?
The IUPAC name of butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate (CID 23338792) is butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate.
What is the SMILES notation for butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate?
The canonical SMILES for butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate is CCCCOC(=O)C1CC(C)=CC(OC)O1.
What is the InChIKey of butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate?
The InChIKey is QCACWWQDZOWTII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-4-5-6-15-12(13)10-7-9(2)8-11(14-3)16-10/h8,10-11H,4-7H2,1-3H3.
What are the key properties of butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate?
butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate has a molecular weight of 228.29 g/mol, XLogP of 2.04, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-methoxy-4-methyl-3,6-dihydro-2H-pyran-2-carboxylate is sourced from PubChem (CID 23338792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).