About 4-(chloromethyl)-1,3-diphenylpyrazole
4-(chloromethyl)-1,3-diphenylpyrazole (PubChem CID 2333908) has the molecular formula C16H13ClN2
and a molecular weight of 268.75 g/mol. Its IUPAC name is 4-(chloromethyl)-1,3-diphenylpyrazole.
Molecular Properties
| Compound Name | 4-(chloromethyl)-1,3-diphenylpyrazole |
| PubChem CID | 2333908 |
| Molecular Formula | C16H13ClN2 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-(chloromethyl)-1,3-diphenylpyrazole |
| SMILES | ClCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H13ClN2/c17-11-14-12-19(15-9-5-2-6-10-15)18-16(14)13-7-3-1-4-8-13/h1-10,12H,11H2 |
| InChIKey | KIJMYHFMHWASDT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-1,3-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-1,3-diphenylpyrazole?
The IUPAC name of 4-(chloromethyl)-1,3-diphenylpyrazole (CID 2333908) is 4-(chloromethyl)-1,3-diphenylpyrazole.
What is the SMILES notation for 4-(chloromethyl)-1,3-diphenylpyrazole?
The canonical SMILES for 4-(chloromethyl)-1,3-diphenylpyrazole is ClCc1cn(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of 4-(chloromethyl)-1,3-diphenylpyrazole?
The InChIKey is KIJMYHFMHWASDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2/c17-11-14-12-19(15-9-5-2-6-10-15)18-16(14)13-7-3-1-4-8-13/h1-10,12H,11H2.
What are the key properties of 4-(chloromethyl)-1,3-diphenylpyrazole?
4-(chloromethyl)-1,3-diphenylpyrazole has a molecular weight of 268.75 g/mol, XLogP of 4.28, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-1,3-diphenylpyrazole is sourced from PubChem (CID 2333908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).