C23H24N4O4S — CID 2333914
3-(3,4-dimethoxyphenyl)-N-(morpholine-4-carbothioyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 2333914) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(morpholine-4-carbothioyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(morpholine-4-carbothioyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2333914 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(morpholine-4-carbothioyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NC(=S)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C23H24N4O4S/c1-29-19-9-8-16(14-20(19)30-2)21-18(15-27(25-21)17-6-4-3-5-7-17)22(28)24-23(32)26-10-12-31-13-11-26/h3-9,14-15H,10-13H2,1-2H3,(H,24,28,32) |
| InChIKey | BGWZLTAXILHCMA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|