About 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine
2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine (PubChem CID 23339439) has the molecular formula C13H18ClNO
and a molecular weight of 239.75 g/mol. Its IUPAC name is 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine.
Molecular Properties
| Compound Name | 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine |
| PubChem CID | 23339439 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine |
| SMILES | CCC1CCCN1C.Clc1cc2ccc1o2 |
| InChI | InChI=1S/C7H15N.C6H3ClO/c1-3-7-5-4-6-8(7)2;7-5-3-4-1-2-6(5)8-4/h7H,3-6H2,1-2H3;1-3H |
| InChIKey | KERFRKWJCPUPFA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine?
The IUPAC name of 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine (CID 23339439) is 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine.
What is the SMILES notation for 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine?
The canonical SMILES for 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine is CCC1CCCN1C.Clc1cc2ccc1o2.
What is the InChIKey of 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine?
The InChIKey is KERFRKWJCPUPFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C6H3ClO/c1-3-7-5-4-6-8(7)2;7-5-3-4-1-2-6(5)8-4/h7H,3-6H2,1-2H3;1-3H.
What are the key properties of 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine?
2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine has a molecular weight of 239.75 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;2-ethyl-1-methylpyrrolidine is sourced from PubChem (CID 23339439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).