About 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine
1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine (PubChem CID 23339719) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine |
| PubChem CID | 23339719 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine |
| SMILES | [N-]=[N+]=C1C=CC(N2CCCC2)=CC1 |
| InChI | InChI=1S/C10H13N3/c11-12-9-3-5-10(6-4-9)13-7-1-2-8-13/h3,5-6H,1-2,4,7-8H2 |
| InChIKey | RWCAXNBYPKHDBR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine?
The IUPAC name of 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine (CID 23339719) is 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine.
What is the SMILES notation for 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine?
The canonical SMILES for 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine is [N-]=[N+]=C1C=CC(N2CCCC2)=CC1.
What is the InChIKey of 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine?
The InChIKey is RWCAXNBYPKHDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c11-12-9-3-5-10(6-4-9)13-7-1-2-8-13/h3,5-6H,1-2,4,7-8H2.
What are the key properties of 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine?
1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine has a molecular weight of 175.23 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-diazocyclohexa-1,5-dien-1-yl)pyrrolidine is sourced from PubChem (CID 23339719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).