C18H17FN4O3 — CID 23339760
benzyl 4-fluoro-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate (PubChem CID 23339760) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is benzyl 4-fluoro-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate.
| Compound Name | benzyl 4-fluoro-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate |
|---|---|
| PubChem CID | 23339760 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | benzyl 4-fluoro-9-oxo-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-12-carboxylate |
| SMILES | O=C1Nc2ccc(F)nc2N2CCN(C(=O)OCc3ccccc3)CC12 |
| InChI | InChI=1S/C18H17FN4O3/c19-15-7-6-13-16(21-15)23-9-8-22(10-14(23)17(24)20-13)18(25)26-11-12-4-2-1-3-5-12/h1-7,14H,8-11H2,(H,20,24) |
| InChIKey | XFEXEDSUGZAVEJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|