About methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate
methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate (PubChem CID 23340181) has the molecular formula C11H12ClN3O2
and a molecular weight of 253.69 g/mol. Its IUPAC name is methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate |
| PubChem CID | 23340181 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate |
| SMILES | COC(=O)NC1=NCC(c2ccccc2Cl)N1 |
| InChI | InChI=1S/C11H12ClN3O2/c1-17-11(16)15-10-13-6-9(14-10)7-4-2-3-5-8(7)12/h2-5,9H,6H2,1H3,(H2,13,14,15,16) |
| InChIKey | PXAFVMSGRCJTBU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate?
The IUPAC name of methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate (CID 23340181) is methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate.
What is the SMILES notation for methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate?
The canonical SMILES for methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate is COC(=O)NC1=NCC(c2ccccc2Cl)N1.
What is the InChIKey of methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate?
The InChIKey is PXAFVMSGRCJTBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3O2/c1-17-11(16)15-10-13-6-9(14-10)7-4-2-3-5-8(7)12/h2-5,9H,6H2,1H3,(H2,13,14,15,16).
What are the key properties of methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate?
methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate has a molecular weight of 253.69 g/mol, XLogP of 1.70, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[5-(2-chlorophenyl)-4,5-dihydro-1H-imidazol-2-yl]carbamate is sourced from PubChem (CID 23340181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).