C24H20N2O4S — CID 2334070
N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-phenoxybenzamide (PubChem CID 2334070) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-phenoxybenzamide.
| Compound Name | N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 2334070 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-3-phenoxybenzamide |
| SMILES | COc1ccc(-c2csc(NC(=O)c3cccc(Oc4ccccc4)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C24H20N2O4S/c1-28-18-11-12-20(22(14-18)29-2)21-15-31-24(25-21)26-23(27)16-7-6-10-19(13-16)30-17-8-4-3-5-9-17/h3-15H,1-2H3,(H,25,26,27) |
| InChIKey | OCJHYHQSDHFFRL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |