About 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol
1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol (PubChem CID 23341032) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol.
Molecular Properties
| Compound Name | 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol |
| PubChem CID | 23341032 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol |
| SMILES | CCN(C1=CCC(=[N+]=[N-])C=C1)C(C)O |
| InChI | InChI=1S/C10H15N3O/c1-3-13(8(2)14)10-6-4-9(12-11)5-7-10/h4,6-8,14H,3,5H2,1-2H3 |
| InChIKey | REUGENZKPCHABS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 59.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol?
The IUPAC name of 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol (CID 23341032) is 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol.
What is the SMILES notation for 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol?
The canonical SMILES for 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol is CCN(C1=CCC(=[N+]=[N-])C=C1)C(C)O.
What is the InChIKey of 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol?
The InChIKey is REUGENZKPCHABS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-3-13(8(2)14)10-6-4-9(12-11)5-7-10/h4,6-8,14H,3,5H2,1-2H3.
What are the key properties of 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol?
1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol has a molecular weight of 193.25 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-diazocyclohexa-1,5-dien-1-yl)-ethylamino]ethanol is sourced from PubChem (CID 23341032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).