About 3,6-dioxocyclohexa-1,4-diene-1-carboxamide
3,6-dioxocyclohexa-1,4-diene-1-carboxamide (PubChem CID 23341318) has the molecular formula C7H5NO3
and a molecular weight of 151.12 g/mol. Its IUPAC name is 3,6-dioxocyclohexa-1,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 3,6-dioxocyclohexa-1,4-diene-1-carboxamide |
| PubChem CID | 23341318 |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 3,6-dioxocyclohexa-1,4-diene-1-carboxamide |
| SMILES | NC(=O)C1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C7H5NO3/c8-7(11)5-3-4(9)1-2-6(5)10/h1-3H,(H2,8,11) |
| InChIKey | OPKLNMXUGSKSTJ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dioxocyclohexa-1,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dioxocyclohexa-1,4-diene-1-carboxamide?
The IUPAC name of 3,6-dioxocyclohexa-1,4-diene-1-carboxamide (CID 23341318) is 3,6-dioxocyclohexa-1,4-diene-1-carboxamide.
What is the SMILES notation for 3,6-dioxocyclohexa-1,4-diene-1-carboxamide?
The canonical SMILES for 3,6-dioxocyclohexa-1,4-diene-1-carboxamide is NC(=O)C1=CC(=O)C=CC1=O.
What is the InChIKey of 3,6-dioxocyclohexa-1,4-diene-1-carboxamide?
The InChIKey is OPKLNMXUGSKSTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3/c8-7(11)5-3-4(9)1-2-6(5)10/h1-3H,(H2,8,11).
What are the key properties of 3,6-dioxocyclohexa-1,4-diene-1-carboxamide?
3,6-dioxocyclohexa-1,4-diene-1-carboxamide has a molecular weight of 151.12 g/mol, XLogP of -0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dioxocyclohexa-1,4-diene-1-carboxamide is sourced from PubChem (CID 23341318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).