C12H8N4OS — CID 23341992
8-amino-3-oxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile (PubChem CID 23341992) has the molecular formula C12H8N4OS and a molecular weight of 256.29 g/mol. Its IUPAC name is 8-amino-3-oxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile.
| Compound Name | 8-amino-3-oxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile |
|---|---|
| PubChem CID | 23341992 |
| Molecular Formula | C12H8N4OS |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 8-amino-3-oxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile |
| SMILES | N#Cc1c2c(c[nH]c1=O)Sc1cc(N)ccc1N2 |
| InChI | InChI=1S/C12H8N4OS/c13-4-7-11-10(5-15-12(7)17)18-9-3-6(14)1-2-8(9)16-11/h1-3,5,16H,14H2,(H,15,17) |
| InChIKey | JEMBRYQOFWNSRB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|