C12H6N4O4S — CID 23341994
8-nitro-3,10-dioxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile (PubChem CID 23341994) has the molecular formula C12H6N4O4S and a molecular weight of 302.27 g/mol. Its IUPAC name is 8-nitro-3,10-dioxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile.
| Compound Name | 8-nitro-3,10-dioxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile |
|---|---|
| PubChem CID | 23341994 |
| Molecular Formula | C12H6N4O4S |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 8-nitro-3,10-dioxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile |
| SMILES | N#Cc1c2c(c[nH]c1=O)S(=O)c1cc([N+](=O)[O-])ccc1N2 |
| InChI | InChI=1S/C12H6N4O4S/c13-4-7-11-10(5-14-12(7)17)21(20)9-3-6(16(18)19)1-2-8(9)15-11/h1-3,5,15H,(H,14,17) |
| InChIKey | JDXHUUCIMFPQKQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 128.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|