C12H6N4O3S — CID 23341997
6-nitro-3-oxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile (PubChem CID 23341997) has the molecular formula C12H6N4O3S and a molecular weight of 286.27 g/mol. Its IUPAC name is 6-nitro-3-oxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile.
| Compound Name | 6-nitro-3-oxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile |
|---|---|
| PubChem CID | 23341997 |
| Molecular Formula | C12H6N4O3S |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 6-nitro-3-oxo-2,5-dihydropyrido[3,4-b][1,4]benzothiazine-4-carbonitrile |
| SMILES | N#Cc1c2c(c[nH]c1=O)Sc1cccc([N+](=O)[O-])c1N2 |
| InChI | InChI=1S/C12H6N4O3S/c13-4-6-10-9(5-14-12(6)17)20-8-3-1-2-7(16(18)19)11(8)15-10/h1-3,5,15H,(H,14,17) |
| InChIKey | FVCQASLQBKWFEC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|