About 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine
6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine (PubChem CID 23342018) has the molecular formula C9H8FNS2
and a molecular weight of 213.30 g/mol. Its IUPAC name is 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine |
| PubChem CID | 23342018 |
| Molecular Formula | C9H8FNS2 |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine |
| SMILES | CSC1=Nc2cc(F)ccc2SC1 |
| InChI | InChI=1S/C9H8FNS2/c1-12-9-5-13-8-3-2-6(10)4-7(8)11-9/h2-4H,5H2,1H3 |
| InChIKey | DKRFXOANCGTCQO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine?
The IUPAC name of 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine (CID 23342018) is 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine.
What is the SMILES notation for 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine?
The canonical SMILES for 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine is CSC1=Nc2cc(F)ccc2SC1.
What is the InChIKey of 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine?
The InChIKey is DKRFXOANCGTCQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNS2/c1-12-9-5-13-8-3-2-6(10)4-7(8)11-9/h2-4H,5H2,1H3.
What are the key properties of 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine?
6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine has a molecular weight of 213.30 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-methylsulfanyl-2H-1,4-benzothiazine is sourced from PubChem (CID 23342018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).