C11H24N2O — CID 23342183
1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)ethanol (PubChem CID 23342183) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)ethanol.
| Compound Name | 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)ethanol |
|---|---|
| PubChem CID | 23342183 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)ethanol |
| SMILES | CC(O)N1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C11H24N2O/c1-8(14)13-10(2,3)6-9(12)7-11(13,4)5/h8-9,14H,6-7,12H2,1-5H3 |
| InChIKey | QJLJRLUNGUONOX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |