About 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine
4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine (PubChem CID 23342292) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine.
Analyze 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine?
The IUPAC name of 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine (CID 23342292) is 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine?
The canonical SMILES for 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine is CCC1NCCc2[nH]cnc21.
What is the InChIKey of 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine?
The InChIKey is RVRGWEYCNVKOQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-6-8-7(3-4-9-6)10-5-11-8/h5-6,9H,2-4H2,1H3,(H,10,11).
What are the key properties of 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine?
4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine has a molecular weight of 151.21 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 23342292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).