About (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium
(4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium (PubChem CID 23342401) has the molecular formula C10H15OS+
and a molecular weight of 183.30 g/mol. Its IUPAC name is (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium.
Molecular Properties
| Compound Name | (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium |
| PubChem CID | 23342401 |
| Molecular Formula | C10H15OS+ |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium |
| SMILES | Cc1cc([S+](C)C)c(C)cc1O |
| InChI | InChI=1S/C10H14OS/c1-7-6-10(12(3)4)8(2)5-9(7)11/h5-6H,1-4H3/p+1 |
| InChIKey | YTTQAGSPSHZGAJ-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium?
The IUPAC name of (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium (CID 23342401) is (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium.
What is the SMILES notation for (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium?
The canonical SMILES for (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium is Cc1cc([S+](C)C)c(C)cc1O.
What is the InChIKey of (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium?
The InChIKey is YTTQAGSPSHZGAJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H14OS/c1-7-6-10(12(3)4)8(2)5-9(7)11/h5-6H,1-4H3/p+1.
What are the key properties of (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium?
(4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium has a molecular weight of 183.30 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-2,5-dimethylphenyl)-dimethylsulfanium is sourced from PubChem (CID 23342401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).