About didecoxy(diethyl)silane
didecoxy(diethyl)silane (PubChem CID 23342517) has the molecular formula C24H52O2Si
and a molecular weight of 400.76 g/mol. Its IUPAC name is didecoxy(diethyl)silane.
Molecular Properties
| Compound Name | didecoxy(diethyl)silane |
| PubChem CID | 23342517 |
| Molecular Formula | C24H52O2Si |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | didecoxy(diethyl)silane |
| SMILES | CCCCCCCCCCO[Si](CC)(CC)OCCCCCCCCCC |
| InChI | InChI=1S/C24H52O2Si/c1-5-9-11-13-15-17-19-21-23-25-27(7-3,8-4)26-24-22-20-18-16-14-12-10-6-2/h5-24H2,1-4H3 |
| InChIKey | UYQNDJHXFBBVGZ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze didecoxy(diethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecoxy(diethyl)silane?
The IUPAC name of didecoxy(diethyl)silane (CID 23342517) is didecoxy(diethyl)silane.
What is the SMILES notation for didecoxy(diethyl)silane?
The canonical SMILES for didecoxy(diethyl)silane is CCCCCCCCCCO[Si](CC)(CC)OCCCCCCCCCC.
What is the InChIKey of didecoxy(diethyl)silane?
The InChIKey is UYQNDJHXFBBVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H52O2Si/c1-5-9-11-13-15-17-19-21-23-25-27(7-3,8-4)26-24-22-20-18-16-14-12-10-6-2/h5-24H2,1-4H3.
What are the key properties of didecoxy(diethyl)silane?
didecoxy(diethyl)silane has a molecular weight of 400.76 g/mol, XLogP of 8.78, 22 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for didecoxy(diethyl)silane is sourced from PubChem (CID 23342517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).