C13H23BrO4 — CID 23342635
5-(3-bromobutyl)-8-(1,3-dioxolan-2-yl)-1,4-dioxocane (PubChem CID 23342635) has the molecular formula C13H23BrO4 and a molecular weight of 323.23 g/mol. Its IUPAC name is 5-(3-bromobutyl)-8-(1,3-dioxolan-2-yl)-1,4-dioxocane.
| Compound Name | 5-(3-bromobutyl)-8-(1,3-dioxolan-2-yl)-1,4-dioxocane |
|---|---|
| PubChem CID | 23342635 |
| Molecular Formula | C13H23BrO4 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-(3-bromobutyl)-8-(1,3-dioxolan-2-yl)-1,4-dioxocane |
| SMILES | CC(Br)CCC1CCC(C2OCCO2)OCCO1 |
| InChI | InChI=1S/C13H23BrO4/c1-10(14)2-3-11-4-5-12(16-7-6-15-11)13-17-8-9-18-13/h10-13H,2-9H2,1H3 |
| InChIKey | FRGVUDRNJJEKEE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|