About 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine
6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine (PubChem CID 23342646) has the molecular formula C18H14N2O
and a molecular weight of 274.32 g/mol. Its IUPAC name is 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine |
| PubChem CID | 23342646 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine |
| SMILES | c1ccc2c(c1)NC(c1ccncc1)c1ccccc1O2 |
| InChI | InChI=1S/C18H14N2O/c1-3-7-16-14(5-1)18(13-9-11-19-12-10-13)20-15-6-2-4-8-17(15)21-16/h1-12,18,20H |
| InChIKey | QKXYKUYCZCSSKJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine?
The IUPAC name of 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine (CID 23342646) is 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine.
What is the SMILES notation for 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine?
The canonical SMILES for 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine is c1ccc2c(c1)NC(c1ccncc1)c1ccccc1O2.
What is the InChIKey of 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine?
The InChIKey is QKXYKUYCZCSSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O/c1-3-7-16-14(5-1)18(13-9-11-19-12-10-13)20-15-6-2-4-8-17(15)21-16/h1-12,18,20H.
What are the key properties of 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine?
6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine has a molecular weight of 274.32 g/mol, XLogP of 4.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyridin-4-yl-5,6-dihydrobenzo[b][1,4]benzoxazepine is sourced from PubChem (CID 23342646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).