About 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide
3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide (PubChem CID 23343227) has the molecular formula C12H22BrF2N3
and a molecular weight of 326.23 g/mol. Its IUPAC name is 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide |
| PubChem CID | 23343227 |
| Molecular Formula | C12H22BrF2N3 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide |
| SMILES | Br.CC(C)c1nc(C(C)C)c(CC(N)C(F)F)[nH]1 |
| InChI | InChI=1S/C12H21F2N3.BrH/c1-6(2)10-9(5-8(15)11(13)14)16-12(17-10)7(3)4;/h6-8,11H,5,15H2,1-4H3,(H,16,17);1H |
| InChIKey | YNYAIUMZJZFMPK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide?
The IUPAC name of 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide (CID 23343227) is 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide.
What is the SMILES notation for 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide?
The canonical SMILES for 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide is Br.CC(C)c1nc(C(C)C)c(CC(N)C(F)F)[nH]1.
What is the InChIKey of 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide?
The InChIKey is YNYAIUMZJZFMPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2N3.BrH/c1-6(2)10-9(5-8(15)11(13)14)16-12(17-10)7(3)4;/h6-8,11H,5,15H2,1-4H3,(H,16,17);1H.
What are the key properties of 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide?
3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide has a molecular weight of 326.23 g/mol, XLogP of 3.37, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,4-di(propan-2-yl)-1H-imidazol-5-yl]-1,1-difluoropropan-2-amine;hydrobromide is sourced from PubChem (CID 23343227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).