About 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide
4,5-dicyano-N,N-dimethylimidazole-1-carboxamide (PubChem CID 23343418) has the molecular formula C8H7N5O
and a molecular weight of 189.18 g/mol. Its IUPAC name is 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide.
Molecular Properties
| Compound Name | 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide |
| PubChem CID | 23343418 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide |
| SMILES | CN(C)C(=O)n1cnc(C#N)c1C#N |
| InChI | InChI=1S/C8H7N5O/c1-12(2)8(14)13-5-11-6(3-9)7(13)4-10/h5H,1-2H3 |
| InChIKey | KIJVREAQCNJNND-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 85.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide?
The IUPAC name of 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide (CID 23343418) is 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide.
What is the SMILES notation for 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide?
The canonical SMILES for 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide is CN(C)C(=O)n1cnc(C#N)c1C#N.
What is the InChIKey of 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide?
The InChIKey is KIJVREAQCNJNND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O/c1-12(2)8(14)13-5-11-6(3-9)7(13)4-10/h5H,1-2H3.
What are the key properties of 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide?
4,5-dicyano-N,N-dimethylimidazole-1-carboxamide has a molecular weight of 189.18 g/mol, XLogP of 0.16, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dicyano-N,N-dimethylimidazole-1-carboxamide is sourced from PubChem (CID 23343418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).