About 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione
7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione (PubChem CID 23343633) has the molecular formula C16H10ClN3O2
and a molecular weight of 311.73 g/mol. Its IUPAC name is 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione.
Molecular Properties
| Compound Name | 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione |
| PubChem CID | 23343633 |
| Molecular Formula | C16H10ClN3O2 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2(c3ccc4ccc(Cl)nc4n3)C=CC=CC12 |
| InChI | InChI=1S/C16H10ClN3O2/c17-12-7-5-9-4-6-11(18-13(9)19-12)16-8-2-1-3-10(16)14(21)20-15(16)22/h1-8,10H,(H,20,21,22) |
| InChIKey | RJLATJCUBXLWQV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione?
The IUPAC name of 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione (CID 23343633) is 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione.
What is the SMILES notation for 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione?
The canonical SMILES for 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione is O=C1NC(=O)C2(c3ccc4ccc(Cl)nc4n3)C=CC=CC12.
What is the InChIKey of 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione?
The InChIKey is RJLATJCUBXLWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3O2/c17-12-7-5-9-4-6-11(18-13(9)19-12)16-8-2-1-3-10(16)14(21)20-15(16)22/h1-8,10H,(H,20,21,22).
What are the key properties of 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione?
7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione has a molecular weight of 311.73 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-(7-chloro-1,8-naphthyridin-2-yl)-3aH-isoindole-1,3-dione is sourced from PubChem (CID 23343633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).