About [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea
[N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea (PubChem CID 23343753) has the molecular formula C9H11FN4O
and a molecular weight of 210.21 g/mol. Its IUPAC name is [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea.
Molecular Properties
| Compound Name | [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea |
| PubChem CID | 23343753 |
| Molecular Formula | C9H11FN4O |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea |
| SMILES | C/N=C(\NC(N)=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C9H11FN4O/c1-12-9(14-8(11)15)13-7-4-2-6(10)3-5-7/h2-5H,1H3,(H4,11,12,13,14,15) |
| InChIKey | DBTSLIBOHIHYMM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea?
The IUPAC name of [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea (CID 23343753) is [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea.
What is the SMILES notation for [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea?
The canonical SMILES for [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea is C/N=C(\NC(N)=O)Nc1ccc(F)cc1.
What is the InChIKey of [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea?
The InChIKey is DBTSLIBOHIHYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN4O/c1-12-9(14-8(11)15)13-7-4-2-6(10)3-5-7/h2-5H,1H3,(H4,11,12,13,14,15).
What are the key properties of [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea?
[N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea has a molecular weight of 210.21 g/mol, XLogP of 0.89, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [N-(4-fluorophenyl)-N'-methylcarbamimidoyl]urea is sourced from PubChem (CID 23343753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).