C6H16CoN3O2+ — CID 23344028
N'-(2-aminoethyl)ethane-1,2-diamine;cobalt(2+);acetate (PubChem CID 23344028) has the molecular formula C6H16CoN3O2+ and a molecular weight of 221.15 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;cobalt(2+);acetate.
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;cobalt(2+);acetate |
|---|---|
| PubChem CID | 23344028 |
| Molecular Formula | C6H16CoN3O2+ |
| Molecular Weight | 221.15 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;cobalt(2+);acetate |
| SMILES | CC(=O)[O-].NCCNCCN.[Co+2] |
| InChI | InChI=1S/C4H13N3.C2H4O2.Co/c5-1-3-7-4-2-6;1-2(3)4;/h7H,1-6H2;1H3,(H,3,4);/q;;+2/p-1 |
| InChIKey | GDHPAXJAQSLUFV-UHFFFAOYSA-M |
| XLogP | -2.75 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.15 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|