C14H24N2O4S — CID 23344253
8,13-dimethyl-8-aza-1-azoniatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene;methyl sulfate (PubChem CID 23344253) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 8,13-dimethyl-8-aza-1-azoniatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene;methyl sulfate.
| Compound Name | 8,13-dimethyl-8-aza-1-azoniatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene;methyl sulfate |
|---|---|
| PubChem CID | 23344253 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 8,13-dimethyl-8-aza-1-azoniatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene;methyl sulfate |
| SMILES | CC1CCCC2=[N+]1CC1=C(CCC1)N2C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H21N2.CH4O4S/c1-10-5-3-8-13-14(2)12-7-4-6-11(12)9-15(10)13;1-5-6(2,3)4/h10H,3-9H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | RGOPXQSLJDQZKV-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|