C14H21NO — CID 23344255
2,3,4,4a,7,8,9,10,11,12a-decahydro-1H-azepino[1,2-b]isoquinolin-5-one (PubChem CID 23344255) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2,3,4,4a,7,8,9,10,11,12a-decahydro-1H-azepino[1,2-b]isoquinolin-5-one.
| Compound Name | 2,3,4,4a,7,8,9,10,11,12a-decahydro-1H-azepino[1,2-b]isoquinolin-5-one |
|---|---|
| PubChem CID | 23344255 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2,3,4,4a,7,8,9,10,11,12a-decahydro-1H-azepino[1,2-b]isoquinolin-5-one |
| SMILES | O=C1C2CCCCC2C=C2CCCCCN12 |
| InChI | InChI=1S/C14H21NO/c16-14-13-8-4-3-6-11(13)10-12-7-2-1-5-9-15(12)14/h10-11,13H,1-9H2 |
| InChIKey | VJMLQIGUZSBNDU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |