C16H16BrN — CID 23344309
8-(3-bromophenyl)-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 23344309) has the molecular formula C16H16BrN and a molecular weight of 302.22 g/mol. Its IUPAC name is 8-(3-bromophenyl)-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 8-(3-bromophenyl)-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 23344309 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 8-(3-bromophenyl)-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CN1CCc2cccc(-c3cccc(Br)c3)c2C1 |
| InChI | InChI=1S/C16H16BrN/c1-18-9-8-12-4-3-7-15(16(12)11-18)13-5-2-6-14(17)10-13/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | JBJHPRQNYUEUEB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |