C18H22ClN — CID 23344353
8-phenyl-3-propyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride (PubChem CID 23344353) has the molecular formula C18H22ClN and a molecular weight of 287.83 g/mol. Its IUPAC name is 8-phenyl-3-propyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride.
| Compound Name | 8-phenyl-3-propyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 23344353 |
| Molecular Formula | C18H22ClN |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 8-phenyl-3-propyl-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| SMILES | CCCC1Cc2cccc(-c3ccccc3)c2CN1.Cl |
| InChI | InChI=1S/C18H21N.ClH/c1-2-7-16-12-15-10-6-11-17(18(15)13-19-16)14-8-4-3-5-9-14;/h3-6,8-11,16,19H,2,7,12-13H2,1H3;1H |
| InChIKey | IKJVRZYMEVAKAJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |