C15H16O6 — CID 23344570
4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylic acid (PubChem CID 23344570) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylic acid.
| Compound Name | 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 23344570 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-hydroxy-4-methyl-6-oxo-2-phenylcyclohexane-1,3-dicarboxylic acid |
| SMILES | CC1(O)CC(=O)C(C(=O)O)C(c2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C15H16O6/c1-15(21)7-9(16)11(13(17)18)10(12(15)14(19)20)8-5-3-2-4-6-8/h2-6,10-12,21H,7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | QVSHAWUYYFGRPM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|