C40H73N7O6 — CID 23344715
3-[3-[decyl-[2-hydroxy-3-(7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propyl]amino]-2-hydroxypropyl]-7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 23344715) has the molecular formula C40H73N7O6 and a molecular weight of 748.07 g/mol. Its IUPAC name is 3-[3-[decyl-[2-hydroxy-3-(7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propyl]amino]-2-hydroxypropyl]-7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[3-[decyl-[2-hydroxy-3-(7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propyl]amino]-2-hydroxypropyl]-7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 23344715 |
| Molecular Formula | C40H73N7O6 |
| Molecular Weight | 748.07 g/mol |
| Exact Mass | 747.56 |
| IUPAC Name | 3-[3-[decyl-[2-hydroxy-3-(7,7,8,9,9-pentamethyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)propyl]amino]-2-hydroxypropyl]-7,7,8,9,9-pentamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCCCCCCCCN(CC(O)CN1C(=O)NC2(CC(C)(C)N(C)C(C)(C)C2)C1=O)CC(O)CN1C(=O)NC2(CC(C)(C)N(C)C(C)(C)C2)C1=O |
| InChI | InChI=1S/C40H73N7O6/c1-12-13-14-15-16-17-18-19-20-45(21-29(48)23-46-31(50)39(41-33(46)52)25-35(2,3)43(10)36(4,5)26-39)22-30(49)24-47-32(51)40(42-34(47)53)27-37(6,7)44(11)38(8,9)28-40/h29-30,48-49H,12-28H2,1-11H3,(H,41,52)(H,42,53) |
| InChIKey | YUHNRRSVIDQZGD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.07 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|