About 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile
1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile (PubChem CID 23344750) has the molecular formula C14H25N3
and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile |
| PubChem CID | 23344750 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile |
| SMILES | CC1CC(C)(C)CC(C#N)(/N=N/C(C)(C)C)C1 |
| InChI | InChI=1S/C14H25N3/c1-11-7-13(5,6)9-14(8-11,10-15)17-16-12(2,3)4/h11H,7-9H2,1-6H3/b17-16+ |
| InChIKey | KWRISGHJMWGWAR-WUKNDPDISA-N |
| XLogP | 4.35 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile?
The IUPAC name of 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile (CID 23344750) is 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile.
What is the SMILES notation for 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile?
The canonical SMILES for 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile is CC1CC(C)(C)CC(C#N)(/N=N/C(C)(C)C)C1.
What is the InChIKey of 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile?
The InChIKey is KWRISGHJMWGWAR-WUKNDPDISA-N. The full InChI is InChI=1S/C14H25N3/c1-11-7-13(5,6)9-14(8-11,10-15)17-16-12(2,3)4/h11H,7-9H2,1-6H3/b17-16+.
What are the key properties of 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile?
1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile has a molecular weight of 235.37 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(tert-butyldiazenyl)-3,3,5-trimethylcyclohexane-1-carbonitrile is sourced from PubChem (CID 23344750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).