About tert-butyl(2,4-dimethyloctan-4-yl)diazene
tert-butyl(2,4-dimethyloctan-4-yl)diazene (PubChem CID 23344799) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is tert-butyl(2,4-dimethyloctan-4-yl)diazene.
Molecular Properties
| Compound Name | tert-butyl(2,4-dimethyloctan-4-yl)diazene |
| PubChem CID | 23344799 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | tert-butyl(2,4-dimethyloctan-4-yl)diazene |
| SMILES | CCCCC(C)(CC(C)C)/N=N/C(C)(C)C |
| InChI | InChI=1S/C14H30N2/c1-8-9-10-14(7,11-12(2)3)16-15-13(4,5)6/h12H,8-11H2,1-7H3/b16-15+ |
| InChIKey | ZZWZSBORECTEKQ-FOCLMDBBSA-N |
| XLogP | 5.23 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(2,4-dimethyloctan-4-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(2,4-dimethyloctan-4-yl)diazene?
The IUPAC name of tert-butyl(2,4-dimethyloctan-4-yl)diazene (CID 23344799) is tert-butyl(2,4-dimethyloctan-4-yl)diazene.
What is the SMILES notation for tert-butyl(2,4-dimethyloctan-4-yl)diazene?
The canonical SMILES for tert-butyl(2,4-dimethyloctan-4-yl)diazene is CCCCC(C)(CC(C)C)/N=N/C(C)(C)C.
What is the InChIKey of tert-butyl(2,4-dimethyloctan-4-yl)diazene?
The InChIKey is ZZWZSBORECTEKQ-FOCLMDBBSA-N. The full InChI is InChI=1S/C14H30N2/c1-8-9-10-14(7,11-12(2)3)16-15-13(4,5)6/h12H,8-11H2,1-7H3/b16-15+.
What are the key properties of tert-butyl(2,4-dimethyloctan-4-yl)diazene?
tert-butyl(2,4-dimethyloctan-4-yl)diazene has a molecular weight of 226.41 g/mol, XLogP of 5.23, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(2,4-dimethyloctan-4-yl)diazene is sourced from PubChem (CID 23344799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).