About ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate
ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate (PubChem CID 23344854) has the molecular formula C27H40O8
and a molecular weight of 492.61 g/mol. Its IUPAC name is ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate.
Molecular Properties
| Compound Name | ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate |
| PubChem CID | 23344854 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate |
| SMILES | CCCCCC(=O)/C=C/c1oc(COC(=O)C(C)(C)C)cc(=O)c1OCCCCCC(=O)OCC |
| InChI | InChI=1S/C27H40O8/c1-6-8-10-13-20(28)15-16-23-25(33-17-12-9-11-14-24(30)32-7-2)22(29)18-21(35-23)19-34-26(31)27(3,4)5/h15-16,18H,6-14,17,19H2,1-5H3/b16-15+ |
| InChIKey | KCZHOCVYGSFIJA-FOCLMDBBSA-N |
| XLogP | 5.39 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate?
The IUPAC name of ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate (CID 23344854) is ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate.
What is the SMILES notation for ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate?
The canonical SMILES for ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate is CCCCCC(=O)/C=C/c1oc(COC(=O)C(C)(C)C)cc(=O)c1OCCCCCC(=O)OCC.
What is the InChIKey of ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate?
The InChIKey is KCZHOCVYGSFIJA-FOCLMDBBSA-N. The full InChI is InChI=1S/C27H40O8/c1-6-8-10-13-20(28)15-16-23-25(33-17-12-9-11-14-24(30)32-7-2)22(29)18-21(35-23)19-34-26(31)27(3,4)5/h15-16,18H,6-14,17,19H2,1-5H3/b16-15+.
What are the key properties of ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate?
ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate has a molecular weight of 492.61 g/mol, XLogP of 5.39, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[6-(2,2-dimethylpropanoyloxymethyl)-4-oxo-2-[(E)-3-oxooct-1-enyl]pyran-3-yl]oxyhexanoate is sourced from PubChem (CID 23344854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).