About 2,2-dicyclohexylbutane-1,3-diamine
2,2-dicyclohexylbutane-1,3-diamine (PubChem CID 23345386) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 2,2-dicyclohexylbutane-1,3-diamine.
Molecular Properties
| Compound Name | 2,2-dicyclohexylbutane-1,3-diamine |
| PubChem CID | 23345386 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2,2-dicyclohexylbutane-1,3-diamine |
| SMILES | CC(N)C(CN)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H32N2/c1-13(18)16(12-17,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h13-15H,2-12,17-18H2,1H3 |
| InChIKey | QNIGCBUZQLPVFM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dicyclohexylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyclohexylbutane-1,3-diamine?
The IUPAC name of 2,2-dicyclohexylbutane-1,3-diamine (CID 23345386) is 2,2-dicyclohexylbutane-1,3-diamine.
What is the SMILES notation for 2,2-dicyclohexylbutane-1,3-diamine?
The canonical SMILES for 2,2-dicyclohexylbutane-1,3-diamine is CC(N)C(CN)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 2,2-dicyclohexylbutane-1,3-diamine?
The InChIKey is QNIGCBUZQLPVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2/c1-13(18)16(12-17,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h13-15H,2-12,17-18H2,1H3.
What are the key properties of 2,2-dicyclohexylbutane-1,3-diamine?
2,2-dicyclohexylbutane-1,3-diamine has a molecular weight of 252.45 g/mol, XLogP of 3.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyclohexylbutane-1,3-diamine is sourced from PubChem (CID 23345386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).