C20H32O4 — CID 23345868
(6-propyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl 6-propyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 23345868) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (6-propyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl 6-propyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | (6-propyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl 6-propyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 23345868 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (6-propyl-7-oxabicyclo[4.1.0]heptan-3-yl)methyl 6-propyl-7-oxabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | CCCC12CCC(COC(=O)C3CCC4(CCC)OC4C3)CC1O2 |
| InChI | InChI=1S/C20H32O4/c1-3-7-19-9-5-14(11-16(19)23-19)13-22-18(21)15-6-10-20(8-4-2)17(12-15)24-20/h14-17H,3-13H2,1-2H3 |
| InChIKey | XOQJRWMDZTXMGB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|