C16H13F6NO2 — CID 23346097
7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 23346097) has the molecular formula C16H13F6NO2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 23346097 |
| Molecular Formula | C16H13F6NO2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | Cc1cc(=O)n2c3c(cc(C(O)(C(F)(F)F)C(F)(F)F)cc13)CCC2 |
| InChI | InChI=1S/C16H13F6NO2/c1-8-5-12(24)23-4-2-3-9-6-10(7-11(8)13(9)23)14(25,15(17,18)19)16(20,21)22/h5-7,25H,2-4H2,1H3 |
| InChIKey | MRXRBJQTNLOYTF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |