About 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol
2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol (PubChem CID 23346457) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol.
Molecular Properties
| Compound Name | 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol |
| PubChem CID | 23346457 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol |
| SMILES | NCC(O)C1=CC2(CC2)c2ccccc21 |
| InChI | InChI=1S/C13H15NO/c14-8-12(15)10-7-13(5-6-13)11-4-2-1-3-9(10)11/h1-4,7,12,15H,5-6,8,14H2 |
| InChIKey | JEAGKESHGLKHGV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol?
The IUPAC name of 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol (CID 23346457) is 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol.
What is the SMILES notation for 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol?
The canonical SMILES for 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol is NCC(O)C1=CC2(CC2)c2ccccc21.
What is the InChIKey of 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol?
The InChIKey is JEAGKESHGLKHGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c14-8-12(15)10-7-13(5-6-13)11-4-2-1-3-9(10)11/h1-4,7,12,15H,5-6,8,14H2.
What are the key properties of 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol?
2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol has a molecular weight of 201.27 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-spiro[cyclopropane-1,3'-indene]-1'-ylethanol is sourced from PubChem (CID 23346457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).