C22H48N2 — CID 23346628
6,7-dipentyldodecane-6,7-diamine (PubChem CID 23346628) has the molecular formula C22H48N2 and a molecular weight of 340.64 g/mol. Its IUPAC name is 6,7-dipentyldodecane-6,7-diamine.
| Compound Name | 6,7-dipentyldodecane-6,7-diamine |
|---|---|
| PubChem CID | 23346628 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | 6,7-dipentyldodecane-6,7-diamine |
| SMILES | CCCCCC(N)(CCCCC)C(N)(CCCCC)CCCCC |
| InChI | InChI=1S/C22H48N2/c1-5-9-13-17-21(23,18-14-10-6-2)22(24,19-15-11-7-3)20-16-12-8-4/h5-20,23-24H2,1-4H3 |
| InChIKey | YEGJAJZNBJJCFJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|