About 3,5-bis(aminomethyl)-2,4-dimethoxyaniline
3,5-bis(aminomethyl)-2,4-dimethoxyaniline (PubChem CID 23346962) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 3,5-bis(aminomethyl)-2,4-dimethoxyaniline.
Molecular Properties
| Compound Name | 3,5-bis(aminomethyl)-2,4-dimethoxyaniline |
| PubChem CID | 23346962 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3,5-bis(aminomethyl)-2,4-dimethoxyaniline |
| SMILES | COc1c(N)cc(CN)c(OC)c1CN |
| InChI | InChI=1S/C10H17N3O2/c1-14-9-6(4-11)3-8(13)10(15-2)7(9)5-12/h3H,4-5,11-13H2,1-2H3 |
| InChIKey | WKFLQTLLGYGGLS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(aminomethyl)-2,4-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(aminomethyl)-2,4-dimethoxyaniline?
The IUPAC name of 3,5-bis(aminomethyl)-2,4-dimethoxyaniline (CID 23346962) is 3,5-bis(aminomethyl)-2,4-dimethoxyaniline.
What is the SMILES notation for 3,5-bis(aminomethyl)-2,4-dimethoxyaniline?
The canonical SMILES for 3,5-bis(aminomethyl)-2,4-dimethoxyaniline is COc1c(N)cc(CN)c(OC)c1CN.
What is the InChIKey of 3,5-bis(aminomethyl)-2,4-dimethoxyaniline?
The InChIKey is WKFLQTLLGYGGLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-14-9-6(4-11)3-8(13)10(15-2)7(9)5-12/h3H,4-5,11-13H2,1-2H3.
What are the key properties of 3,5-bis(aminomethyl)-2,4-dimethoxyaniline?
3,5-bis(aminomethyl)-2,4-dimethoxyaniline has a molecular weight of 211.26 g/mol, XLogP of 0.20, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(aminomethyl)-2,4-dimethoxyaniline is sourced from PubChem (CID 23346962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).