About 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one
4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one (PubChem CID 23347078) has the molecular formula C9H4Br2Cl2O
and a molecular weight of 358.84 g/mol. Its IUPAC name is 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one.
Molecular Properties
| Compound Name | 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one |
| PubChem CID | 23347078 |
| Molecular Formula | C9H4Br2Cl2O |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 355.80 |
| IUPAC Name | 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one |
| SMILES | O=C1Cc2c(Br)c(Cl)c(Cl)c(Br)c2C1 |
| InChI | InChI=1S/C9H4Br2Cl2O/c10-6-4-1-3(14)2-5(4)7(11)9(13)8(6)12/h1-2H2 |
| InChIKey | WUVGAJNECJWYOO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one?
The IUPAC name of 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one (CID 23347078) is 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one.
What is the SMILES notation for 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one?
The canonical SMILES for 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one is O=C1Cc2c(Br)c(Cl)c(Cl)c(Br)c2C1.
What is the InChIKey of 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one?
The InChIKey is WUVGAJNECJWYOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Br2Cl2O/c10-6-4-1-3(14)2-5(4)7(11)9(13)8(6)12/h1-2H2.
What are the key properties of 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one?
4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one has a molecular weight of 358.84 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dibromo-5,6-dichloro-1,3-dihydroinden-2-one is sourced from PubChem (CID 23347078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).