About N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide
N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide (PubChem CID 23347790) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide.
Molecular Properties
| Compound Name | N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide |
| PubChem CID | 23347790 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide |
| SMILES | O=CNC1CCC(=O)c2sccc21 |
| InChI | InChI=1S/C9H9NO2S/c11-5-10-7-1-2-8(12)9-6(7)3-4-13-9/h3-5,7H,1-2H2,(H,10,11) |
| InChIKey | OVYSXAZBCBIOSB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide?
The IUPAC name of N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide (CID 23347790) is N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide.
What is the SMILES notation for N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide?
The canonical SMILES for N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide is O=CNC1CCC(=O)c2sccc21.
What is the InChIKey of N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide?
The InChIKey is OVYSXAZBCBIOSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c11-5-10-7-1-2-8(12)9-6(7)3-4-13-9/h3-5,7H,1-2H2,(H,10,11).
What are the key properties of N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide?
N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide has a molecular weight of 195.24 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-oxo-5,6-dihydro-4H-1-benzothiophen-4-yl)formamide is sourced from PubChem (CID 23347790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).