About 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one
4-amino-5,6-dihydro-4H-1-benzothiophen-7-one (PubChem CID 23347796) has the molecular formula C8H9NOS
and a molecular weight of 167.23 g/mol. Its IUPAC name is 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one.
Molecular Properties
| Compound Name | 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one |
| PubChem CID | 23347796 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one |
| SMILES | NC1CCC(=O)c2sccc21 |
| InChI | InChI=1S/C8H9NOS/c9-6-1-2-7(10)8-5(6)3-4-11-8/h3-4,6H,1-2,9H2 |
| InChIKey | MAKLVOVYKONBGP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one?
The IUPAC name of 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one (CID 23347796) is 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one.
What is the SMILES notation for 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one?
The canonical SMILES for 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one is NC1CCC(=O)c2sccc21.
What is the InChIKey of 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one?
The InChIKey is MAKLVOVYKONBGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS/c9-6-1-2-7(10)8-5(6)3-4-11-8/h3-4,6H,1-2,9H2.
What are the key properties of 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one?
4-amino-5,6-dihydro-4H-1-benzothiophen-7-one has a molecular weight of 167.23 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5,6-dihydro-4H-1-benzothiophen-7-one is sourced from PubChem (CID 23347796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).