About (4-chlorophenyl) 3,4-diaminobenzenesulfonate
(4-chlorophenyl) 3,4-diaminobenzenesulfonate (PubChem CID 23347917) has the molecular formula C12H11ClN2O3S
and a molecular weight of 298.75 g/mol. Its IUPAC name is (4-chlorophenyl) 3,4-diaminobenzenesulfonate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 3,4-diaminobenzenesulfonate |
| PubChem CID | 23347917 |
| Molecular Formula | C12H11ClN2O3S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | (4-chlorophenyl) 3,4-diaminobenzenesulfonate |
| SMILES | Nc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2)cc1N |
| InChI | InChI=1S/C12H11ClN2O3S/c13-8-1-3-9(4-2-8)18-19(16,17)10-5-6-11(14)12(15)7-10/h1-7H,14-15H2 |
| InChIKey | SWXAXGYVTNHQPF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 3,4-diaminobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 3,4-diaminobenzenesulfonate?
The IUPAC name of (4-chlorophenyl) 3,4-diaminobenzenesulfonate (CID 23347917) is (4-chlorophenyl) 3,4-diaminobenzenesulfonate.
What is the SMILES notation for (4-chlorophenyl) 3,4-diaminobenzenesulfonate?
The canonical SMILES for (4-chlorophenyl) 3,4-diaminobenzenesulfonate is Nc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2)cc1N.
What is the InChIKey of (4-chlorophenyl) 3,4-diaminobenzenesulfonate?
The InChIKey is SWXAXGYVTNHQPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O3S/c13-8-1-3-9(4-2-8)18-19(16,17)10-5-6-11(14)12(15)7-10/h1-7H,14-15H2.
What are the key properties of (4-chlorophenyl) 3,4-diaminobenzenesulfonate?
(4-chlorophenyl) 3,4-diaminobenzenesulfonate has a molecular weight of 298.75 g/mol, XLogP of 2.27, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 3,4-diaminobenzenesulfonate is sourced from PubChem (CID 23347917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).