C12H19Cl4NO — CID 23348000
4,4-dimethyl-2-(3,5,5,5-tetrachloro-2,2-dimethylpentyl)-5H-1,3-oxazole (PubChem CID 23348000) has the molecular formula C12H19Cl4NO and a molecular weight of 335.10 g/mol. Its IUPAC name is 4,4-dimethyl-2-(3,5,5,5-tetrachloro-2,2-dimethylpentyl)-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-(3,5,5,5-tetrachloro-2,2-dimethylpentyl)-5H-1,3-oxazole |
|---|---|
| PubChem CID | 23348000 |
| Molecular Formula | C12H19Cl4NO |
| Molecular Weight | 335.10 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 4,4-dimethyl-2-(3,5,5,5-tetrachloro-2,2-dimethylpentyl)-5H-1,3-oxazole |
| SMILES | CC1(C)COC(CC(C)(C)C(Cl)CC(Cl)(Cl)Cl)=N1 |
| InChI | InChI=1S/C12H19Cl4NO/c1-10(2,8(13)5-12(14,15)16)6-9-17-11(3,4)7-18-9/h8H,5-7H2,1-4H3 |
| InChIKey | HTAUYOFCAQXHNM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.10 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|