C16H21NO — CID 23348019
5-benzyl-2-(2,2-dimethylbut-3-enyl)-4,5-dihydro-1,3-oxazole (PubChem CID 23348019) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 5-benzyl-2-(2,2-dimethylbut-3-enyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 5-benzyl-2-(2,2-dimethylbut-3-enyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 23348019 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 5-benzyl-2-(2,2-dimethylbut-3-enyl)-4,5-dihydro-1,3-oxazole |
| SMILES | C=CC(C)(C)CC1=NCC(Cc2ccccc2)O1 |
| InChI | InChI=1S/C16H21NO/c1-4-16(2,3)11-15-17-12-14(18-15)10-13-8-6-5-7-9-13/h4-9,14H,1,10-12H2,2-3H3 |
| InChIKey | IEHZVMAEFWATQK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|