C18H16N2O5S — CID 23348115
3-[(3-amino-4-methylbenzoyl)amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 23348115) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-[(3-amino-4-methylbenzoyl)amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 3-[(3-amino-4-methylbenzoyl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 23348115 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-[(3-amino-4-methylbenzoyl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(C(=O)Nc2c(S(=O)(=O)O)cc3ccccc3c2O)cc1N |
| InChI | InChI=1S/C18H16N2O5S/c1-10-6-7-12(8-14(10)19)18(22)20-16-15(26(23,24)25)9-11-4-2-3-5-13(11)17(16)21/h2-9,21H,19H2,1H3,(H,20,22)(H,23,24,25) |
| InChIKey | WDAINGBPTXVCMF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|